cas: 145872-59-9 — see every product listed under this CAS number, including other names
2-((4-Aminobenzyl)sulfonyl)ethanol, 95%+, 95%+ (CAS 145872-59-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112DH5-100mg |
| cas | 145872-59-9 |
| size | 100mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1715.60 Pln | |
| Chemat | 250mg | 3371.60 Pln | |
| Chemat | 1g | 6266.00 Pln |
| purity | 95%+ |
|---|---|
| delivery time | 3 weeks |
2-[(4-aminophenyl)methylsulfonyl]ethanol (CAS 145872-59-9) is a chemical compound with the molecular formula C9H13NO3S and a molecular weight of 215.27 g/mol. IUPAC name: 2-[(4-aminophenyl)methylsulfonyl]ethanol. InChIKey: HWMLEMOAAGCZRL-UHFFFAOYSA-N.
| Molecular formula | C9H13NO3S |
|---|---|
| Molecular weight | 215.27 g/mol |
| IUPAC name | 2-[(4-aminophenyl)methylsulfonyl]ethanol |
| InChIKey | HWMLEMOAAGCZRL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CS(=O)(=O)CCO)N |
Computed by PubChem (NCBI)