cas: 3169-85-5 — see every product listed under this CAS number, including other names
2-((4-Fluorophenyl)thio)aniline 98% (CAS 3169-85-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1379606-100mg |
| cas | 3169-85-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 453.81 Pln | |
| Ambeed | 250mg | 720.81 Pln | |
| Ambeed | 1g | 1888.94 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1379606 |
2-(4-fluorophenyl)sulfanylaniline (CAS 3169-85-5) is a chemical compound with the molecular formula C12H10FNS and a molecular weight of 219.28 g/mol. IUPAC name: 2-(4-fluorophenyl)sulfanylaniline. InChIKey: PVQSNTZPQXXQRN-UHFFFAOYSA-N.
| Molecular formula | C12H10FNS |
|---|---|
| Molecular weight | 219.28 g/mol |
| IUPAC name | 2-(4-fluorophenyl)sulfanylaniline |
| InChIKey | PVQSNTZPQXXQRN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)N)SC2=CC=C(C=C2)F |
Computed by PubChem (NCBI)