cas: 10106-41-9 — see every product listed under this CAS number, including other names
2-((8S,10S,13S,14S,16R,17R)-17-Hydroxy-10,13,16-trimethyl-3-oxo-6,7,8,10,12,13,14,15,16,17-decahydro-3H-cyclopenta[a]phenanthren-17-yl)-2-oxoethyl acetate, 98%, 98% (CAS 10106-41-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119WOH-100mg |
| cas | 10106-41-9 |
| size | 100mg |
| availability | 1.1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1005.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
[2-[(8S,10S,13S,14S,16R,17R)-17-hydroxy-10,13,16-trimethyl-3-oxo-7,8,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate (CAS 10106-41-9) is a chemical compound with the molecular formula C24H30O5 and a molecular weight of 398.5 g/mol. IUPAC name: [2-[(8S,10S,13S,14S,16R,17R)-17-hydroxy-10,13,16-trimethyl-3-oxo-7,8,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate. InChIKey: AAPZMQVULRVUEU-PYAFTSMNSA-N.
| Molecular formula | C24H30O5 |
|---|---|
| Molecular weight | 398.5 g/mol |
| IUPAC name | [2-[(8S,10S,13S,14S,16R,17R)-17-hydroxy-10,13,16-trimethyl-3-oxo-7,8,12,14,15,16-hexahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl] acetate |
| InChIKey | AAPZMQVULRVUEU-PYAFTSMNSA-N |
| SMILES | C[C@@H]1C[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@@]4(C3=CC[C@@]2([C@]1(C(=O)COC(=O)C)O)C)C |
Computed by PubChem (NCBI)