cas: 1823273-17-1 — see every product listed under this CAS number, including other names
2-((Benzyloxy)carbonyl)-1-fluorocyclopropanecarboxylic acid, 95+% (CAS 1823273-17-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A182093-100mg |
| cas | 1823273-17-1 |
| size | 100mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 100mg | 4386.13 Pln | |
| AmBeed | 1g | 19450.27 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
1-fluoro-2-phenylmethoxycarbonylcyclopropane-1-carboxylic acid (CAS 1823273-17-1) is a chemical compound with the molecular formula C12H11FO4 and a molecular weight of 238.21 g/mol. IUPAC name: 1-fluoro-2-phenylmethoxycarbonylcyclopropane-1-carboxylic acid. InChIKey: BMOCFAXVYKDLGW-UHFFFAOYSA-N.
| Molecular formula | C12H11FO4 |
|---|---|
| Molecular weight | 238.21 g/mol |
| IUPAC name | 1-fluoro-2-phenylmethoxycarbonylcyclopropane-1-carboxylic acid |
| InChIKey | BMOCFAXVYKDLGW-UHFFFAOYSA-N |
| SMILES | C1C(C1(C(=O)O)F)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)