cas: 849062-17-5 — see every product listed under this CAS number, including other names
2-([2,2':5',2''-Terthiophen]-5-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane 95% (CAS 849062-17-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A479610-100mg |
| cas | 849062-17-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 515.00 Pln | |
| Ambeed | 250mg | 848.75 Pln | |
| Ambeed | 1g | 2078.06 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A479610 |
4,4,5,5-tetramethyl-2-[5-(5-thiophen-2-ylthiophen-2-yl)thiophen-2-yl]-1,3,2-dioxaborolane (CAS 849062-17-5) is a chemical compound with the molecular formula C18H19BO2S3 and a molecular weight of 374.4 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-[5-(5-thiophen-2-ylthiophen-2-yl)thiophen-2-yl]-1,3,2-dioxaborolane. InChIKey: FIUQKESHHZFUGG-UHFFFAOYSA-N.
| Molecular formula | C18H19BO2S3 |
|---|---|
| Molecular weight | 374.4 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-[5-(5-thiophen-2-ylthiophen-2-yl)thiophen-2-yl]-1,3,2-dioxaborolane |
| InChIKey | FIUQKESHHZFUGG-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(S2)C3=CC=C(S3)C4=CC=CS4 |
Computed by PubChem (NCBI)