cas: 849021-37-0 — see every product listed under this CAS number, including other names
2-(1,3-Benzoxazol-2-yl)-1-[3-(trifluoromethyl)phenyl]ethanone (CAS 849021-37-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F013886-1G |
| cas | 849021-37-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 1008.00 Pln | |
| Fluorochem | 5g | 2189.87 Pln | |
| Fluorochem | 10g | 3902.81 Pln |
| delivery time | 2-3 weeks |
|---|
2-(1,3-benzoxazol-2-yl)-1-[3-(trifluoromethyl)phenyl]ethanone (CAS 849021-37-0) is a chemical compound with the molecular formula C16H10F3NO2 and a molecular weight of 305.25 g/mol. IUPAC name: 2-(1,3-benzoxazol-2-yl)-1-[3-(trifluoromethyl)phenyl]ethanone. InChIKey: DSCUBZCFWVJMGX-UHFFFAOYSA-N.
| Molecular formula | C16H10F3NO2 |
|---|---|
| Molecular weight | 305.25 g/mol |
| IUPAC name | 2-(1,3-benzoxazol-2-yl)-1-[3-(trifluoromethyl)phenyl]ethanone |
| InChIKey | DSCUBZCFWVJMGX-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(O2)CC(=O)C3=CC(=CC=C3)C(F)(F)F |
Computed by PubChem (NCBI)