cas: 850567-55-4 — see every product listed under this CAS number, including other names
2-(1-(4-Fluorophenyl)vinyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane 98% (CAS 850567-55-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A581120-100mg |
| cas | 850567-55-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 259.12 Pln | |
| Ambeed | 250mg | 520.56 Pln | |
| Ambeed | 1g | 1811.06 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A581120 |
2-[1-(4-fluorophenyl)ethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 850567-55-4) is a chemical compound with the molecular formula C14H18BFO2 and a molecular weight of 248.10 g/mol. IUPAC name: 2-[1-(4-fluorophenyl)ethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: BNROZDXKAQJDJC-UHFFFAOYSA-N.
| Molecular formula | C14H18BFO2 |
|---|---|
| Molecular weight | 248.10 g/mol |
| IUPAC name | 2-[1-(4-fluorophenyl)ethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | BNROZDXKAQJDJC-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C(=C)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)