cas: 415727-02-5 — see every product listed under this CAS number, including other names
2-(1-Phenylvinyl)-1,3,2-dioxaborinane, 96% mix TBC as stabilizer, 96% mix TBC as stabilizer (CAS 415727-02-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114EPN-250mg |
| cas | 415727-02-5 |
| size | 250mg |
| availability | 4g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 150.80 Pln | |
| Chemat | 1g | 304.40 Pln |
| purity | 96% mix TBC as stabilizer |
|---|---|
| delivery time | 3 weeks |
2-(1-phenylethenyl)-1,3,2-dioxaborinane (CAS 415727-02-5) is a chemical compound with the molecular formula C11H13BO2 and a molecular weight of 188.03 g/mol. IUPAC name: 2-(1-phenylethenyl)-1,3,2-dioxaborinane. InChIKey: UJNPUKGUVLOFOZ-UHFFFAOYSA-N.
| Molecular formula | C11H13BO2 |
|---|---|
| Molecular weight | 188.03 g/mol |
| IUPAC name | 2-(1-phenylethenyl)-1,3,2-dioxaborinane |
| InChIKey | UJNPUKGUVLOFOZ-UHFFFAOYSA-N |
| SMILES | B1(OCCCO1)C(=C)C2=CC=CC=C2 |
Computed by PubChem (NCBI)