cas: 1334529-08-6 — see every product listed under this CAS number, including other names
2-(2,4,6-Trimethyl-phenyl)-2,5,6,7-tetrahydro-pyrrolo[2,1-c][1,2,4]triazol-4-ylium perchlorate, 98%, 98% (CAS 1334529-08-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 10mg, 50mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110F9O-250mg |
| cas | 1334529-08-6 |
| size | 250mg |
| availability | 1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 1638.80 Pln | |
| Chemat | 1g | 5589.20 Pln | |
| Chemat | 10mg | 184.40 Pln | |
| Chemat | 50mg | 477.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-(2,4,6-trimethylphenyl)-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-4-ium perchlorate (CAS 1334529-08-6) is a chemical compound with the molecular formula C14H18ClN3O4 and a molecular weight of 327.76 g/mol. IUPAC name: 2-(2,4,6-trimethylphenyl)-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-4-ium perchlorate. InChIKey: LWDOZOIYYGPFSI-UHFFFAOYSA-M.
| Molecular formula | C14H18ClN3O4 |
|---|---|
| Molecular weight | 327.76 g/mol |
| IUPAC name | 2-(2,4,6-trimethylphenyl)-6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-4-ium perchlorate |
| InChIKey | LWDOZOIYYGPFSI-UHFFFAOYSA-M |
| SMILES | CC1=CC(=C(C(=C1)C)N2C=[N+]3CCCC3=N2)C.[O-]Cl(=O)(=O)=O |
Computed by PubChem (NCBI)