cas: 1073339-07-7 — see every product listed under this CAS number, including other names
2-(2,5-Dimethoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 97%, 97% (CAS 1073339-07-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118ENR-1g |
| cas | 1073339-07-7 |
| size | 1g |
| availability | 190g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 107.60 Pln | |
| Chemat | 10g | 150.80 Pln | |
| Chemat | 25g | 280.40 Pln | |
| Chemat | 100g | 822.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-(2,5-dimethoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1073339-07-7) is a chemical compound with the molecular formula C14H21BO4 and a molecular weight of 264.13 g/mol. IUPAC name: 2-(2,5-dimethoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: XJCGLLQYWCVCSS-UHFFFAOYSA-N.
| Molecular formula | C14H21BO4 |
|---|---|
| Molecular weight | 264.13 g/mol |
| IUPAC name | 2-(2,5-dimethoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | XJCGLLQYWCVCSS-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)OC)OC |
Computed by PubChem (NCBI)