cas: 1451391-10-8 — see every product listed under this CAS number, including other names
2-(2,6-Difluoro-3-nitrophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane 95% (CAS 1451391-10-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A558586-100mg |
| cas | 1451391-10-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 292.50 Pln | |
| Ambeed | 250mg | 409.31 Pln | |
| Ambeed | 1g | 748.62 Pln | |
| Ambeed | 5g | 2795.62 Pln | |
| Ambeed | 25g | 10127.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A558586 |
2-(2,6-difluoro-3-nitrophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1451391-10-8) is a chemical compound with the molecular formula C12H14BF2NO4 and a molecular weight of 285.05 g/mol. IUPAC name: 2-(2,6-difluoro-3-nitrophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: ROUNPYXYPTVUGB-UHFFFAOYSA-N.
| Molecular formula | C12H14BF2NO4 |
|---|---|
| Molecular weight | 285.05 g/mol |
| IUPAC name | 2-(2,6-difluoro-3-nitrophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | ROUNPYXYPTVUGB-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2F)[N+](=O)[O-])F |
Computed by PubChem (NCBI)