cas: 851231-30-6 — see every product listed under this CAS number, including other names
2-(2,6-Dimethoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane 98% (CAS 851231-30-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1004770-1g |
| cas | 851231-30-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 220.19 Pln | |
| Ambeed | 25g | 804.25 Pln | |
| Ambeed | 100g | 2556.44 Pln | |
| Ambeed | 500g | 10021.31 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A1004770 |
2-(2,6-dimethoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 851231-30-6) is a chemical compound with the molecular formula C14H21BO4 and a molecular weight of 264.13 g/mol. IUPAC name: 2-(2,6-dimethoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: FZSMHXDGONFVOO-UHFFFAOYSA-N.
| Molecular formula | C14H21BO4 |
|---|---|
| Molecular weight | 264.13 g/mol |
| IUPAC name | 2-(2,6-dimethoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | FZSMHXDGONFVOO-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC=C2OC)OC |
Computed by PubChem (NCBI)