2-(2,6-Dimethyl-4-(trifluoromethyl)phenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%
cas: 2223051-36-1 — see every product listed under this CAS number, including other names
2-(2,6-Dimethyl-4-(trifluoromethyl)phenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98% (CAS 2223051-36-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 50mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A232681-100mg |
| cas | 2223051-36-1 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 1443.94 Pln | |
| Ambeed | 250mg | 2406.25 Pln | |
| Ambeed | 1g | 8241.31 Pln | |
| Chemat | 50mg | 875.60 Pln | |
| Chemat | 100mg | 1446.80 Pln | |
| Chemat | 250mg | 2411.60 Pln | |
| Chemat | 1g | 7782.80 Pln | |
| BLDpharm | 50mg | 936.36 Pln | |
| BLDpharm | 100mg | 1541.70 Pln | |
| BLDpharm | 250mg | 2569.12 Pln | |
| BLDpharm | 1g | 8816.92 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
2-[2,6-dimethyl-4-(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2223051-36-1) is a chemical compound with the molecular formula C15H20BF3O2 and a molecular weight of 300.13 g/mol. IUPAC name: 2-[2,6-dimethyl-4-(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: IJYRPCWEQCIMQP-UHFFFAOYSA-N.
| Molecular formula | C15H20BF3O2 |
|---|---|
| Molecular weight | 300.13 g/mol |
| IUPAC name | 2-[2,6-dimethyl-4-(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | IJYRPCWEQCIMQP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2C)C(F)(F)F)C |
Computed by PubChem (NCBI)