Products 134179-43-4

CAS 134179-43-4 is the registry number for 2-(2-(2-(2-Azidoethoxy)ethoxy)ethoxy)ethyl methanesulfonate, 98%, 98%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethyl methanesulfonate (CAS 134179-43-4) is a chemical compound with the molecular formula C9H19N3O6S and a molecular weight of 297.33 g/mol. IUPAC name: 2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethyl methanesulfonate. InChIKey: FEQHUCSCQXKLNK-UHFFFAOYSA-N.

Identity
Molecular formulaC9H19N3O6S
Molecular weight297.33 g/mol
IUPAC name2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethyl methanesulfonate
InChIKeyFEQHUCSCQXKLNK-UHFFFAOYSA-N
SMILESCS(=O)(=O)OCCOCCOCCOCCN=[N+]=[N-]

Computed by PubChem (NCBI)