2-(2-(Hexyloxy)ethyl)-N1,N3-dimethyl-N1,N3-dioctylmalonamide, 98%
cas: 107513-23-5 — see every product listed under this CAS number, including other names
2-(2-(Hexyloxy)ethyl)-N1,N3-dimethyl-N1,N3-dioctylmalonamide, 98% (CAS 107513-23-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A2437214-100mg |
| cas | 107513-23-5 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 220.19 Pln | |
| Ambeed | 250mg | 337.00 Pln | |
| Ambeed | 1g | 759.75 Pln | |
| Ambeed | 5g | 2317.25 Pln | |
| Ambeed | 10g | 3897.00 Pln | |
| BLDpharm | 100mg | 231.05 Pln | |
| BLDpharm | 250mg | 353.23 Pln | |
| BLDpharm | 1g | 814.18 Pln | |
| BLDpharm | 5g | 2496.92 Pln | |
| BLDpharm | 10g | 4196.32 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
2-(2-hexoxyethyl)-N,N'-dimethyl-N,N'-dioctylpropanediamide (CAS 107513-23-5) is a chemical compound with the molecular formula C29H58N2O3 and a molecular weight of 482.8 g/mol. IUPAC name: 2-(2-hexoxyethyl)-N,N'-dimethyl-N,N'-dioctylpropanediamide. InChIKey: QEHSHNRQHFAQEH-UHFFFAOYSA-N.
| Molecular formula | C29H58N2O3 |
|---|---|
| Molecular weight | 482.8 g/mol |
| IUPAC name | 2-(2-hexoxyethyl)-N,N'-dimethyl-N,N'-dioctylpropanediamide |
| InChIKey | QEHSHNRQHFAQEH-UHFFFAOYSA-N |
| SMILES | CCCCCCCCN(C)C(=O)C(CCOCCCCCC)C(=O)N(C)CCCCCCCC |
Computed by PubChem (NCBI)
Synonyms:
Propanediamide, 2-[2-(hexyloxy)ethyl]-N,N'-dimethyl-N,N'-dioctyl-, 2-[2-(Hexyloxy)ethyl]-N~1~,N~3~-dimethyl-N~1~,N~3~-dioctylpropanediamide, 2-(2-hexoxyethyl)-N,N'-dimethyl-N,N'-dioctylpropanediamide, 2-(2-(Hexyloxy)ethyl)-N1,N3-dimethyl-N1,N3-dioctylmalonamide, 2-(2-hexyloxy-ethyl)-N,N'-dimethyl-N,N'-dioctyl-malonamide