2-(2-(Trityloxy)ethoxy)ethyl methanesulfonate, 95%
cas: 146462-58-0 — see every product listed under this CAS number, including other names
2-(2-(Trityloxy)ethoxy)ethyl methanesulfonate, 95% (CAS 146462-58-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 50mg, 100mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1374606-250mg |
| cas | 146462-58-0 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 1138.00 Pln | |
| Ambeed | 1g | 2956.94 Pln | |
| Chemat | 50mg | 304.40 Pln | |
| Chemat | 100mg | 472.40 Pln | |
| Chemat | 250mg | 760.40 Pln | |
| Chemat | 1g | 1950.80 Pln | |
| BLDpharm | 50mg | 469.86 Pln | |
| BLDpharm | 100mg | 747.54 Pln | |
| BLDpharm | 250mg | 1225.15 Pln | |
| BLDpharm | 1g | 3185.57 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
2-(2-trityloxyethoxy)ethyl methanesulfonate (CAS 146462-58-0) is a chemical compound with the molecular formula C24H26O5S and a molecular weight of 426.5 g/mol. IUPAC name: 2-(2-trityloxyethoxy)ethyl methanesulfonate. InChIKey: ANIXWRGNISWFBY-UHFFFAOYSA-N.
| Molecular formula | C24H26O5S |
|---|---|
| Molecular weight | 426.5 g/mol |
| IUPAC name | 2-(2-trityloxyethoxy)ethyl methanesulfonate |
| InChIKey | ANIXWRGNISWFBY-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)OCCOCCOC(C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)