cas: 524674-04-2 — see every product listed under this CAS number, including other names
2-(2-(trifluoromethyl)phenyl)pyrrolidine hydrochloride (CAS 524674-04-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F300165-250MG |
| cas | 524674-04-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 362.39 Pln | |
| Fluorochem | 1g | 674.78 Pln |
| delivery time | 2-3 weeks |
|---|
2-[2-(trifluoromethyl)phenyl]pyrrolidine (CAS 524674-04-2) is a chemical compound with the molecular formula C11H12F3N and a molecular weight of 215.21 g/mol. IUPAC name: 2-[2-(trifluoromethyl)phenyl]pyrrolidine. InChIKey: DRQIUNNVQDIWJF-UHFFFAOYSA-N.
| Molecular formula | C11H12F3N |
|---|---|
| Molecular weight | 215.21 g/mol |
| IUPAC name | 2-[2-(trifluoromethyl)phenyl]pyrrolidine |
| InChIKey | DRQIUNNVQDIWJF-UHFFFAOYSA-N |
| SMILES | C1CC(NC1)C2=CC=CC=C2C(F)(F)F |
Computed by PubChem (NCBI)