cas: 2092501-01-2 — see every product listed under this CAS number, including other names
2-(2-{((9H-fluoren-9-ylmethoxy)carbonyl)amino}ethyl)-4-methyl-1,3-thiazole-5-carboxylic acid, 95% (CAS 2092501-01-2) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1135269-1g |
| cas | 2092501-01-2 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 16572.85 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethyl]-4-methyl-1,3-thiazole-5-carboxylic acid (CAS 2092501-01-2) is a chemical compound with the molecular formula C22H20N2O4S and a molecular weight of 408.5 g/mol. IUPAC name: 2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethyl]-4-methyl-1,3-thiazole-5-carboxylic acid. InChIKey: ZMAYXELJHIDUHU-UHFFFAOYSA-N.
| Molecular formula | C22H20N2O4S |
|---|---|
| Molecular weight | 408.5 g/mol |
| IUPAC name | 2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethyl]-4-methyl-1,3-thiazole-5-carboxylic acid |
| InChIKey | ZMAYXELJHIDUHU-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)CCNC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C(=O)O |
Computed by PubChem (NCBI)