cas: 352530-05-3 — see every product listed under this CAS number, including other names
2-(2-Aminobenzo[d]thiazol-6-yl)acetonitrile, 95%, 95% (CAS 352530-05-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11CLB8-100mg |
| cas | 352530-05-3 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 280.40 Pln | |
| Chemat | 250mg | 429.20 Pln | |
| Chemat | 1g | 1053.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-(2-amino-1,3-benzothiazol-6-yl)acetonitrile (CAS 352530-05-3) is a chemical compound with the molecular formula C9H7N3S and a molecular weight of 189.24 g/mol. IUPAC name: 2-(2-amino-1,3-benzothiazol-6-yl)acetonitrile. InChIKey: KAUYEYJEFMZZGK-UHFFFAOYSA-N.
| Molecular formula | C9H7N3S |
|---|---|
| Molecular weight | 189.24 g/mol |
| IUPAC name | 2-(2-amino-1,3-benzothiazol-6-yl)acetonitrile |
| InChIKey | KAUYEYJEFMZZGK-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1CC#N)SC(=N2)N |
Computed by PubChem (NCBI)