cas: 2121513-56-0 — see every product listed under this CAS number, including other names
2-(2-Bromo-3-(trifluoromethyl)phenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 97% (CAS 2121513-56-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A647001-5g |
| cas | 2121513-56-0 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 7771.33 Pln | |
| AmBeed | 25g | 25882.15 Pln | |
| AmBeed | 10g | 13187.65 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-[2-bromo-3-(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2121513-56-0) is a chemical compound with the molecular formula C13H15BBrF3O2 and a molecular weight of 350.97 g/mol. IUPAC name: 2-[2-bromo-3-(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: IDUZBJPSTPAOJJ-UHFFFAOYSA-N.
| Molecular formula | C13H15BBrF3O2 |
|---|---|
| Molecular weight | 350.97 g/mol |
| IUPAC name | 2-[2-bromo-3-(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | IDUZBJPSTPAOJJ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C(=CC=C2)C(F)(F)F)Br |
Computed by PubChem (NCBI)