cas: 2121514-01-8 — see every product listed under this CAS number, including other names
2-(2-Bromo-4-(trifluoromethoxy)phenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95% (CAS 2121514-01-8) is a chemical reagent available from Chemat. Available pack sizes: 25g, 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A645444-25g |
| cas | 2121514-01-8 |
| size | 25g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 25g | 50509.48 Pln | |
| AmBeed | 10g | 25712.89 Pln | |
| AmBeed | 5g | 15134.14 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-[2-bromo-4-(trifluoromethoxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2121514-01-8) is a chemical compound with the molecular formula C13H15BBrF3O3 and a molecular weight of 366.97 g/mol. IUPAC name: 2-[2-bromo-4-(trifluoromethoxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: ZOQYDMSNSGWVRP-UHFFFAOYSA-N.
| Molecular formula | C13H15BBrF3O3 |
|---|---|
| Molecular weight | 366.97 g/mol |
| IUPAC name | 2-[2-bromo-4-(trifluoromethoxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | ZOQYDMSNSGWVRP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)OC(F)(F)F)Br |
Computed by PubChem (NCBI)