2-(2-Fluoro-5-methoxy-3-(trifluoromethyl)phenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95%
cas: 2828446-17-7 — see every product listed under this CAS number, including other names
2-(2-Fluoro-5-methoxy-3-(trifluoromethyl)phenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95% (CAS 2828446-17-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A1627438-250mg |
| cas | 2828446-17-7 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 248.00 Pln | |
| Ambeed | 1g | 531.69 Pln | |
| Ambeed | 5g | 1683.12 Pln | |
| BLDpharm | 100mg | 169.96 Pln | |
| BLDpharm | 250mg | 242.16 Pln | |
| BLDpharm | 1g | 519.84 Pln | |
| BLDpharm | 5g | 1652.78 Pln | |
| Chemat | 250mg | 227.60 Pln | |
| Chemat | 1g | 506.00 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
2-[2-fluoro-5-methoxy-3-(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2828446-17-7) is a chemical compound with the molecular formula C14H17BF4O3 and a molecular weight of 320.09 g/mol. IUPAC name: 2-[2-fluoro-5-methoxy-3-(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: MEVZAAPWOXKTIV-UHFFFAOYSA-N.
| Molecular formula | C14H17BF4O3 |
|---|---|
| Molecular weight | 320.09 g/mol |
| IUPAC name | 2-[2-fluoro-5-methoxy-3-(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | MEVZAAPWOXKTIV-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2F)C(F)(F)F)OC |
Computed by PubChem (NCBI)