cas: 79784-34-2 — see every product listed under this CAS number, including other names
2-(3,4-Difluorophenyl)-2-oxoacetaldehyde, 95%, 95% (CAS 79784-34-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119LCR-1g |
| cas | 79784-34-2 |
| size | 1g |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 179.60 Pln | |
| Chemat | 5g | 472.40 Pln | |
| Chemat | 10g | 880.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-(3,4-difluorophenyl)-2-oxoacetaldehyde (CAS 79784-34-2) is a chemical compound with the molecular formula C8H4F2O2 and a molecular weight of 170.11 g/mol. IUPAC name: 2-(3,4-difluorophenyl)-2-oxoacetaldehyde. InChIKey: VZRYIZGMQICGSF-UHFFFAOYSA-N.
| Molecular formula | C8H4F2O2 |
|---|---|
| Molecular weight | 170.11 g/mol |
| IUPAC name | 2-(3,4-difluorophenyl)-2-oxoacetaldehyde |
| InChIKey | VZRYIZGMQICGSF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)C=O)F)F |
Computed by PubChem (NCBI)