cas: 365564-10-9 — see every product listed under this CAS number, including other names
2-(3,4-Dimethoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane 97% (CAS 365564-10-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A193794-250mg |
| cas | 365564-10-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 147.88 Pln | |
| Ambeed | 10g | 175.69 Pln | |
| Ambeed | 25g | 325.88 Pln | |
| Ambeed | 100g | 1010.06 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A193794 |
2-(3,4-dimethoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 365564-10-9) is a chemical compound with the molecular formula C14H21BO4 and a molecular weight of 264.13 g/mol. IUPAC name: 2-(3,4-dimethoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: QPWUFMRNTUHMJD-UHFFFAOYSA-N.
| Molecular formula | C14H21BO4 |
|---|---|
| Molecular weight | 264.13 g/mol |
| IUPAC name | 2-(3,4-dimethoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | QPWUFMRNTUHMJD-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)OC)OC |
Computed by PubChem (NCBI)