2-(3,5-Difluoro-4-(trifluoromethyl)phenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98%
cas: 1251844-06-0 — see every product listed under this CAS number, including other names
2-(3,5-Difluoro-4-(trifluoromethyl)phenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98% (CAS 1251844-06-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F758493-250MG |
| cas | 1251844-06-0 |
| size | 250mg |
| availability | In Stock Germany |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 133.30 Pln | |
| Fluorochem | 1g | 268.67 Pln | |
| Ambeed | 250mg | 136.75 Pln | |
| Ambeed | 1g | 270.25 Pln | |
| Ambeed | 5g | 854.31 Pln | |
| Chemat | 100mg | 102.80 Pln | |
| Chemat | 250mg | 126.80 Pln | |
| Chemat | 1g | 304.40 Pln | |
| Chemat | 5g | 1269.20 Pln | |
| BLDpharm | 100mg | 125.54 Pln | |
| BLDpharm | 250mg | 142.20 Pln | |
| BLDpharm | 1g | 286.59 Pln | |
| BLDpharm | 5g | 914.15 Pln |
properties
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 5-10 days |
| category | Odczynniki chemiczne |
2-[3,5-difluoro-4-(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1251844-06-0) is a chemical compound with the molecular formula C13H14BF5O2 and a molecular weight of 308.05 g/mol. IUPAC name: 2-[3,5-difluoro-4-(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: HJRPDUSMHNOSPO-UHFFFAOYSA-N.
| Molecular formula | C13H14BF5O2 |
|---|---|
| Molecular weight | 308.05 g/mol |
| IUPAC name | 2-[3,5-difluoro-4-(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | HJRPDUSMHNOSPO-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C(=C2)F)C(F)(F)F)F |
Computed by PubChem (NCBI)
Synonyms:
starbld0017261