2-(3,5-Difluorophenyl)-5,5-dimethyl-1,3,2-dioxaborinane, ≥97-<99%
cas: 216393-57-6 — see every product listed under this CAS number, including other names
2-(3,5-Difluorophenyl)-5,5-dimethyl-1,3,2-dioxaborinane, ≥97-<99% (CAS 216393-57-6) is a chemical reagent available from Chemat. Available pack sizes: 50g, 100g, 200g, 300g, 400g, 500g. Offered by: Hoffman Fine Chemicals.
| brand | Hoffman Fine Chemicals |
|---|---|
| catalog number | HFC230-97-99-50g |
| cas | 216393-57-6 |
| size | 50g |
| availability | 3-4 tygodnie|3-4 weeks |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Hoffman Fine Chemicals | 50g | 4033.92 Pln | |
| Hoffman Fine Chemicals | 100g | 6177.60 Pln | |
| Hoffman Fine Chemicals | 200g | 9699.36 Pln | |
| Hoffman Fine Chemicals | 300g | 11581.46 Pln | |
| Hoffman Fine Chemicals | 400g | 13080.76 Pln | |
| Hoffman Fine Chemicals | 500g | 13878.26 Pln |
properties
| purity | ≥97-<99% |
|---|---|
| category | Chemicals |
| delivery time | 3-4 weeks |
2-(3,5-difluorophenyl)-5,5-dimethyl-1,3,2-dioxaborinane (CAS 216393-57-6) is a chemical compound with the molecular formula C11H13BF2O2 and a molecular weight of 226.03 g/mol. IUPAC name: 2-(3,5-difluorophenyl)-5,5-dimethyl-1,3,2-dioxaborinane. InChIKey: OLHRAEPCGZMMTI-UHFFFAOYSA-N.
| Molecular formula | C11H13BF2O2 |
|---|---|
| Molecular weight | 226.03 g/mol |
| IUPAC name | 2-(3,5-difluorophenyl)-5,5-dimethyl-1,3,2-dioxaborinane |
| InChIKey | OLHRAEPCGZMMTI-UHFFFAOYSA-N |
| SMILES | B1(OCC(CO1)(C)C)C2=CC(=CC(=C2)F)F |
Computed by PubChem (NCBI)
Synonyms:
2-(3,5-difluorophenyl)-5,5-dimethyl-1,3,2-dioxaborinane, 3,5-Difluorobenzeneboronic acid neopentyl glycol ester, 3,5-Difluorophenylboronic acid neopentyl glycol ester, 2-(3,5-difluorophenyl)-5,5-dimethyl-1,3,2-dioxaborane, 1,3,2-Dioxaborinane, 2-(3,5-difluorophenyl)-5,5-dimethyl-, 3,5-difluorobenzeneboronic acid neopentyl glycol, 3,5-Difluorophenylboronic acidneopentylglycol ester, 3,5-Difluorobenzenebornoic acid neopentyl glycol cyclic ester