cas: 383128-39-0 — see every product listed under this CAS number, including other names
2-(3,5-Dimethylphenyl)piperidine 95% (CAS 383128-39-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A615393-100mg |
| cas | 383128-39-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 236.88 Pln | |
| Ambeed | 250mg | 331.44 Pln | |
| Ambeed | 1g | 743.06 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A615393 |
2-(3,5-dimethylphenyl)piperidine (CAS 383128-39-0) is a chemical compound with the molecular formula C13H19N and a molecular weight of 189.30 g/mol. IUPAC name: 2-(3,5-dimethylphenyl)piperidine. InChIKey: ITOUMWCWDRQGPJ-UHFFFAOYSA-N.
| Molecular formula | C13H19N |
|---|---|
| Molecular weight | 189.30 g/mol |
| IUPAC name | 2-(3,5-dimethylphenyl)piperidine |
| InChIKey | ITOUMWCWDRQGPJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)C2CCCCN2)C |
Computed by PubChem (NCBI)