cas: 2246858-67-1 — see every product listed under this CAS number, including other names
2-(3-((2-Bromophenoxy)methyl)phenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95%, 95% (CAS 2246858-67-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12FKZO-250mg |
| cas | 2246858-67-1 |
| size | 250mg |
| availability | 5.22g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 875.60 Pln | |
| Chemat | 1g | 1782.80 Pln | |
| Chemat | 5g | 5229.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-[3-[(2-bromophenoxy)methyl]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2246858-67-1) is a chemical compound with the molecular formula C19H22BBrO3 and a molecular weight of 389.1 g/mol. IUPAC name: 2-[3-[(2-bromophenoxy)methyl]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: YSXPEPYQZVWRFT-UHFFFAOYSA-N.
| Molecular formula | C19H22BBrO3 |
|---|---|
| Molecular weight | 389.1 g/mol |
| IUPAC name | 2-[3-[(2-bromophenoxy)methyl]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | YSXPEPYQZVWRFT-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)COC3=CC=CC=C3Br |
Computed by PubChem (NCBI)