cas: 2246779-56-4 — see every product listed under this CAS number, including other names
2-(3-((3,4-Dichlorobenzyl)oxy)phenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98% (CAS 2246779-56-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F782287-100MG |
| cas | 2246779-56-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 237.43 Pln | |
| Fluorochem | 250mg | 482.14 Pln | |
| Fluorochem | 1g | 955.93 Pln | |
| Fluorochem | 5g | 3038.53 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2-[3-[(3,4-dichlorophenyl)methoxy]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2246779-56-4) is a chemical compound with the molecular formula C19H21BCl2O3 and a molecular weight of 379.1 g/mol. IUPAC name: 2-[3-[(3,4-dichlorophenyl)methoxy]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: JXASGTYWJGICQR-UHFFFAOYSA-N.
| Molecular formula | C19H21BCl2O3 |
|---|---|
| Molecular weight | 379.1 g/mol |
| IUPAC name | 2-[3-[(3,4-dichlorophenyl)methoxy]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | JXASGTYWJGICQR-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)OCC3=CC(=C(C=C3)Cl)Cl |
Computed by PubChem (NCBI)