cas: 1648930-13-5 — see every product listed under this CAS number, including other names
2-(3-((4-Fluorophenoxy)methyl)phenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95-<97% (CAS 1648930-13-5) is a chemical reagent available from Chemat. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g. Offered by: Hoffman Fine Chemicals.
| brand | Hoffman Fine Chemicals |
|---|---|
| catalog number | HFC934-95-97-2.5g |
| cas | 1648930-13-5 |
| size | 2,5g |
| availability | 3-4 tygodnie|3-4 weeks |
| brand | size | price | |
|---|---|---|---|
| Hoffman Fine Chemicals | 2,5g | 5501.32 Pln | |
| Hoffman Fine Chemicals | 5g | 8614.76 Pln | |
| Hoffman Fine Chemicals | 10g | 13597.54 Pln | |
| Hoffman Fine Chemicals | 25g | 26887.08 Pln | |
| Hoffman Fine Chemicals | 50g | 45491.16 Pln |
| purity | 95-<97% |
|---|---|
| category | Chemicals |
| delivery time | 3-4 weeks |
2-[3-[(4-fluorophenoxy)methyl]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1648930-13-5) is a chemical compound with the molecular formula C19H22BFO3 and a molecular weight of 328.2 g/mol. IUPAC name: 2-[3-[(4-fluorophenoxy)methyl]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: IDTNRIFLTBTFMV-UHFFFAOYSA-N.
| Molecular formula | C19H22BFO3 |
|---|---|
| Molecular weight | 328.2 g/mol |
| IUPAC name | 2-[3-[(4-fluorophenoxy)methyl]phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | IDTNRIFLTBTFMV-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)COC3=CC=C(C=C3)F |
Computed by PubChem (NCBI)