cas: 2121514-90-5 — see every product listed under this CAS number, including other names
2-(3-(Benzyloxy)-6-bromo-2-fluorophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98% (CAS 2121514-90-5) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A637494-10g |
| cas | 2121514-90-5 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 6755.77 Pln | |
| AmBeed | 25g | 13272.28 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-(6-bromo-2-fluoro-3-phenylmethoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2121514-90-5) is a chemical compound with the molecular formula C19H21BBrFO3 and a molecular weight of 407.1 g/mol. IUPAC name: 2-(6-bromo-2-fluoro-3-phenylmethoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: GCZDXELPQZNTSJ-UHFFFAOYSA-N.
| Molecular formula | C19H21BBrFO3 |
|---|---|
| Molecular weight | 407.1 g/mol |
| IUPAC name | 2-(6-bromo-2-fluoro-3-phenylmethoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | GCZDXELPQZNTSJ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2F)OCC3=CC=CC=C3)Br |
Computed by PubChem (NCBI)