2-(3-(Ethylsulfonyl)-5-(trifluoromethyl)phenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95%
cas: 1354047-99-6 — see every product listed under this CAS number, including other names
2-(3-(Ethylsulfonyl)-5-(trifluoromethyl)phenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95% (CAS 1354047-99-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A2418188-250mg |
| cas | 1354047-99-6 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 1199.19 Pln | |
| Ambeed | 1g | 3045.94 Pln | |
| Ambeed | 5g | 8992.25 Pln | |
| Chemat | 100mg | 645.20 Pln | |
| Chemat | 250mg | 990.80 Pln | |
| Chemat | 1g | 2474.00 Pln | |
| Chemat | 5g | 6818.00 Pln | |
| BLDpharm | 100mg | 836.40 Pln | |
| BLDpharm | 250mg | 1286.24 Pln | |
| BLDpharm | 1g | 3274.43 Pln | |
| BLDpharm | 5g | 9688.84 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
2-[3-ethylsulfonyl-5-(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1354047-99-6) is a chemical compound with the molecular formula C15H20BF3O4S and a molecular weight of 364.2 g/mol. IUPAC name: 2-[3-ethylsulfonyl-5-(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: QJZGYDSXYQOPHL-UHFFFAOYSA-N.
| Molecular formula | C15H20BF3O4S |
|---|---|
| Molecular weight | 364.2 g/mol |
| IUPAC name | 2-[3-ethylsulfonyl-5-(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | QJZGYDSXYQOPHL-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2)S(=O)(=O)CC)C(F)(F)F |
Computed by PubChem (NCBI)