2-(3-Bromo-2-chlorophenyl)acetonitrile, 95%
cas: 1261438-68-9 — see every product listed under this CAS number, including other names
2-(3-Bromo-2-chlorophenyl)acetonitrile, 95% (CAS 1261438-68-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 5g, 100mg, 1g, 10g, 25g. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A1736365-250mg |
| cas | 1261438-68-9 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 1377.19 Pln | |
| Ambeed | 5g | 7696.19 Pln | |
| BLDpharm | 100mg | 819.74 Pln | |
| BLDpharm | 250mg | 1480.61 Pln | |
| BLDpharm | 1g | 3407.71 Pln | |
| BLDpharm | 5g | 8289.33 Pln | |
| Chemat | 100mg | 760.40 Pln | |
| Chemat | 250mg | 1379.60 Pln | |
| Chemat | 1g | 1499.60 Pln | |
| Chemat | 5g | 4379.60 Pln | |
| Chemat | 10g | 7259.60 Pln | |
| Chemat | 25g | 14450.00 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
2-(3-bromo-2-chlorophenyl)acetonitrile (CAS 1261438-68-9) is a chemical compound with the molecular formula C8H5BrClN and a molecular weight of 230.49 g/mol. IUPAC name: 2-(3-bromo-2-chlorophenyl)acetonitrile. InChIKey: JFZBZXFNUIULCL-UHFFFAOYSA-N.
| Molecular formula | C8H5BrClN |
|---|---|
| Molecular weight | 230.49 g/mol |
| IUPAC name | 2-(3-bromo-2-chlorophenyl)acetonitrile |
| InChIKey | JFZBZXFNUIULCL-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Br)Cl)CC#N |
Computed by PubChem (NCBI)