cas: 1099623-16-1 — see every product listed under this CAS number, including other names
2-(3-Fluorophenyl)-5,5-dimethylmorpholine, 97% (CAS 1099623-16-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A996214-1g |
| cas | 1099623-16-1 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 5994.10 Pln | |
| AmBeed | 5g | 9919.63 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-(3-fluorophenyl)-5,5-dimethylmorpholine (CAS 1099623-16-1) is a chemical compound with the molecular formula C12H16FNO and a molecular weight of 209.26 g/mol. IUPAC name: 2-(3-fluorophenyl)-5,5-dimethylmorpholine. InChIKey: MVNHMIHGVNHOFP-UHFFFAOYSA-N.
| Molecular formula | C12H16FNO |
|---|---|
| Molecular weight | 209.26 g/mol |
| IUPAC name | 2-(3-fluorophenyl)-5,5-dimethylmorpholine |
| InChIKey | MVNHMIHGVNHOFP-UHFFFAOYSA-N |
| SMILES | CC1(COC(CN1)C2=CC(=CC=C2)F)C |
Computed by PubChem (NCBI)