cas: 5457-29-4 — see every product listed under this CAS number, including other names
2-(3-Iodopropyl)isoindoline-1,3-dione 95% (CAS 5457-29-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A824907-250mg |
| cas | 5457-29-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 242.44 Pln | |
| Ambeed | 1g | 464.94 Pln | |
| Ambeed | 5g | 1616.38 Pln | |
| Ambeed | 25g | 6099.75 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A824907 |
2-(3-iodopropyl)isoindole-1,3-dione (CAS 5457-29-4) is a chemical compound with the molecular formula C11H10INO2 and a molecular weight of 315.11 g/mol. IUPAC name: 2-(3-iodopropyl)isoindole-1,3-dione. InChIKey: LKSISOJOXOBDGH-UHFFFAOYSA-N.
| Molecular formula | C11H10INO2 |
|---|---|
| Molecular weight | 315.11 g/mol |
| IUPAC name | 2-(3-iodopropyl)isoindole-1,3-dione |
| InChIKey | LKSISOJOXOBDGH-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)CCCI |
Computed by PubChem (NCBI)