cas: 1159803-56-1 — see every product listed under this CAS number, including other names
2-(3-Methoxyphenyl)-2,3-dihydro-1H-naphtho[1,8-de][1,3,2]diazaborinine, 98%, 98% (CAS 1159803-56-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HD69-100mg |
| cas | 1159803-56-1 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 342.80 Pln | |
| Chemat | 250mg | 534.80 Pln | |
| Chemat | 1g | 1341.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-(3-methoxyphenyl)-2,4-diaza-3-boratricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene (CAS 1159803-56-1) is a chemical compound with the molecular formula C17H15BN2O and a molecular weight of 274.1 g/mol. IUPAC name: 3-(3-methoxyphenyl)-2,4-diaza-3-boratricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene. InChIKey: KQWSJBNQJNULIJ-UHFFFAOYSA-N.
| Molecular formula | C17H15BN2O |
|---|---|
| Molecular weight | 274.1 g/mol |
| IUPAC name | 3-(3-methoxyphenyl)-2,4-diaza-3-boratricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaene |
| InChIKey | KQWSJBNQJNULIJ-UHFFFAOYSA-N |
| SMILES | B1(NC2=CC=CC3=C2C(=CC=C3)N1)C4=CC(=CC=C4)OC |
Computed by PubChem (NCBI)