cas: 3572-66-5 — see every product listed under this CAS number, including other names
2-(3-Oxo-2-(pent-2-en-1-yl)cyclopentyl)acetic acid, 98%, 98% (CAS 3572-66-5) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 50mg, 100mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BZAG-25mg |
| cas | 3572-66-5 |
| size | 25mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25mg | 419.60 Pln | |
| Chemat | 50mg | 674.00 Pln | |
| Chemat | 100mg | 1130.00 Pln | |
| Chemat | 500mg | 3597.20 Pln | |
| Chemat | 1g | 5987.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-[3-oxo-2-[(E)-pent-2-enyl]cyclopentyl]acetic acid (CAS 3572-66-5) is a chemical compound with the molecular formula C12H18O3 and a molecular weight of 210.27 g/mol. IUPAC name: 2-[3-oxo-2-[(E)-pent-2-enyl]cyclopentyl]acetic acid. InChIKey: ZNJFBWYDHIGLCU-ONEGZZNKSA-N.
| Molecular formula | C12H18O3 |
|---|---|
| Molecular weight | 210.27 g/mol |
| IUPAC name | 2-[3-oxo-2-[(E)-pent-2-enyl]cyclopentyl]acetic acid |
| InChIKey | ZNJFBWYDHIGLCU-ONEGZZNKSA-N |
| SMILES | CC/C=C/CC1C(CCC1=O)CC(=O)O |
Computed by PubChem (NCBI)