cas: 32852-95-2 — see every product listed under this CAS number, including other names
2-(3-phenoxyphenyl)propanenitrile, 95%, 95% (CAS 32852-95-2) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 50mg, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11493V-25mg |
| cas | 32852-95-2 |
| size | 25mg |
| availability | 0.2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25mg | 2128.40 Pln | |
| Chemat | 50mg | 3165.20 Pln | |
| Chemat | 100mg | 5574.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-(3-phenoxyphenyl)propanenitrile (CAS 32852-95-2) is a chemical compound with the molecular formula C15H13NO and a molecular weight of 223.27 g/mol. IUPAC name: 2-(3-phenoxyphenyl)propanenitrile. InChIKey: JSCONFOVXYGOST-UHFFFAOYSA-N.
| Molecular formula | C15H13NO |
|---|---|
| Molecular weight | 223.27 g/mol |
| IUPAC name | 2-(3-phenoxyphenyl)propanenitrile |
| InChIKey | JSCONFOVXYGOST-UHFFFAOYSA-N |
| SMILES | CC(C#N)C1=CC(=CC=C1)OC2=CC=CC=C2 |
Computed by PubChem (NCBI)