cas: 1073355-21-1 — see every product listed under this CAS number, including other names
2-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethyl)benzonitrile, 95% (CAS 1073355-21-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F228484-250MG |
| cas | 1073355-21-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 128.10 Pln | |
| Fluorochem | 1g | 164.54 Pln | |
| Fluorochem | 5g | 565.44 Pln | |
| Fluorochem | 10g | 1070.47 Pln | |
| Fluorochem | 25g | 2590.77 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethyl)benzonitrile (CAS 1073355-21-1) is a chemical compound with the molecular formula C14H15BF3NO2 and a molecular weight of 297.08 g/mol. IUPAC name: 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethyl)benzonitrile. InChIKey: OINNEFWMBQNRSL-UHFFFAOYSA-N.
| Molecular formula | C14H15BF3NO2 |
|---|---|
| Molecular weight | 297.08 g/mol |
| IUPAC name | 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethyl)benzonitrile |
| InChIKey | OINNEFWMBQNRSL-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)C(F)(F)F)C#N |
Computed by PubChem (NCBI)