cas: 871125-67-6 — see every product listed under this CAS number, including other names
2-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-9,9a-dihydro-4aH-carbazole, 96%, 96% (CAS 871125-67-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119FFC-1g |
| cas | 871125-67-6 |
| size | 1g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 107.60 Pln | |
| Chemat | 5g | 227.60 Pln | |
| Chemat | 10g | 366.80 Pln | |
| Chemat | 100mg | 88.40 Pln | |
| Chemat | 250mg | 102.80 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-9H-carbazole (CAS 871125-67-6) is a chemical compound with the molecular formula C18H20BNO2 and a molecular weight of 293.2 g/mol. IUPAC name: 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-9H-carbazole. InChIKey: RLSJGSFDSSYNPL-UHFFFAOYSA-N.
| Molecular formula | C18H20BNO2 |
|---|---|
| Molecular weight | 293.2 g/mol |
| IUPAC name | 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-9H-carbazole |
| InChIKey | RLSJGSFDSSYNPL-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=C2)C4=CC=CC=C4N3 |
Computed by PubChem (NCBI)