2-(4,4-Difluorocyclohex-1-en-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 97%
cas: 1227068-84-9 — see every product listed under this CAS number, including other names
2-(4,4-Difluorocyclohex-1-en-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 97% (CAS 1227068-84-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100mg, 10g, 50g, 100g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A156040-250mg |
| cas | 1227068-84-9 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 131.19 Pln | |
| Ambeed | 1g | 281.38 Pln | |
| Ambeed | 5g | 759.75 Pln | |
| Ambeed | 25g | 2484.12 Pln | |
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 146.00 Pln | |
| Chemat | 5g | 405.20 Pln | |
| Chemat | 10g | 669.20 Pln | |
| Chemat | 25g | 1302.80 Pln | |
| Chemat | 50g | 2128.40 Pln | |
| Chemat | 100g | 3923.60 Pln | |
| Chemat | 250g | 8176.40 Pln | |
| Chemat | 500g | 14889.60 Pln | |
| BLDpharm | 100mg | 125.54 Pln | |
| BLDpharm | 250mg | 136.64 Pln | |
| BLDpharm | 1g | 225.50 Pln | |
| BLDpharm | 5g | 808.63 Pln | |
| BLDpharm | 10g | 1269.58 Pln | |
| BLDpharm | 25g | 2635.76 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
2-(4,4-difluorocyclohexen-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 1227068-84-9) is a chemical compound with the molecular formula C12H19BF2O2 and a molecular weight of 244.09 g/mol. IUPAC name: 2-(4,4-difluorocyclohexen-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: WSLRIJFIFPFAFB-UHFFFAOYSA-N.
| Molecular formula | C12H19BF2O2 |
|---|---|
| Molecular weight | 244.09 g/mol |
| IUPAC name | 2-(4,4-difluorocyclohexen-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | WSLRIJFIFPFAFB-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CCC(CC2)(F)F |
Computed by PubChem (NCBI)
Synonyms:
2-(4,4-Difluorocyclohex-1-en-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 4,4-Difluorocyclohexene-1-boronic Acid Pinacol Ester, 4,4-Difluoro-1-cyclohexene-1-boronic acid pinacol ester, 2-(4,4-difluorocyclohexen-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 2-(4,4-difluorocyclohex-1-enyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 2-(4,4-Difluorocyclohex-1-en-1-yl)-4,4,5,5-tetra methyl-1,3,2-dioxaborolane