cas: 2152645-00-4 — see every product listed under this CAS number, including other names
2-(4,4-difluorocyclohexyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 97%, 97% (CAS 2152645-00-4) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11J8NC-50mg |
| cas | 2152645-00-4 |
| size | 50mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 419.60 Pln | |
| Chemat | 100mg | 669.20 Pln | |
| Chemat | 250mg | 1034.00 Pln | |
| Chemat | 1g | 2334.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2-(4,4-difluorocyclohexyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2152645-00-4) is a chemical compound with the molecular formula C12H21BF2O2 and a molecular weight of 246.10 g/mol. IUPAC name: 2-(4,4-difluorocyclohexyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: PSISDAHBTZUUKR-UHFFFAOYSA-N.
| Molecular formula | C12H21BF2O2 |
|---|---|
| Molecular weight | 246.10 g/mol |
| IUPAC name | 2-(4,4-difluorocyclohexyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | PSISDAHBTZUUKR-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2CCC(CC2)(F)F |
Computed by PubChem (NCBI)