cas: 186046-78-6 — see every product listed under this CAS number, including other names
2-(4-(((Benzhydryloxy)carbonyl)amino)-2-oxopyrimidin-1(2H)-yl)acetic acid, 98%, 98% (CAS 186046-78-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1187B8-100mg |
| cas | 186046-78-6 |
| size | 100mg |
| availability | 200g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 117.20 Pln | |
| Chemat | 250mg | 150.80 Pln | |
| Chemat | 1g | 266.00 Pln | |
| Chemat | 5g | 544.40 Pln | |
| Chemat | 10g | 890.00 Pln | |
| Chemat | 25g | 1442.00 Pln | |
| Chemat | 100g | 4197.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-[4-(benzhydryloxycarbonylamino)-2-oxopyrimidin-1-yl]acetic acid (CAS 186046-78-6) is a chemical compound with the molecular formula C20H17N3O5 and a molecular weight of 379.4 g/mol. IUPAC name: 2-[4-(benzhydryloxycarbonylamino)-2-oxopyrimidin-1-yl]acetic acid. InChIKey: VPWKJWIKZUONJA-UHFFFAOYSA-N.
| Molecular formula | C20H17N3O5 |
|---|---|
| Molecular weight | 379.4 g/mol |
| IUPAC name | 2-[4-(benzhydryloxycarbonylamino)-2-oxopyrimidin-1-yl]acetic acid |
| InChIKey | VPWKJWIKZUONJA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)OC(=O)NC3=NC(=O)N(C=C3)CC(=O)O |
Computed by PubChem (NCBI)