cas: 2377606-39-6 — see every product listed under this CAS number, including other names
2-(4-(2-Fluoro-4-nitrophenoxy)phenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 98% (CAS 2377606-39-6) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1616870-10g |
| cas | 2377606-39-6 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 10225.60 Pln | |
| AmBeed | 5g | 6417.25 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
2-[4-(2-fluoro-4-nitrophenoxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 2377606-39-6) is a chemical compound with the molecular formula C18H19BFNO5 and a molecular weight of 359.2 g/mol. IUPAC name: 2-[4-(2-fluoro-4-nitrophenoxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: RTVGWKVWPDHTMV-UHFFFAOYSA-N.
| Molecular formula | C18H19BFNO5 |
|---|---|
| Molecular weight | 359.2 g/mol |
| IUPAC name | 2-[4-(2-fluoro-4-nitrophenoxy)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | RTVGWKVWPDHTMV-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)OC3=C(C=C(C=C3)[N+](=O)[O-])F |
Computed by PubChem (NCBI)