cas: 101078-75-5 — see every product listed under this CAS number, including other names
2-(4-(Bromomethyl)phenyl)-6-methoxybenzo[d]thiazole, 95%, 95% (CAS 101078-75-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1114O2-250mg |
| cas | 101078-75-5 |
| size | 250mg |
| availability | 9.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 750.80 Pln | |
| Chemat | 1g | 1782.80 Pln | |
| Chemat | 5g | 3165.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-[4-(bromomethyl)phenyl]-6-methoxy-1,3-benzothiazole (CAS 101078-75-5) is a chemical compound with the molecular formula C15H12BrNOS and a molecular weight of 334.2 g/mol. IUPAC name: 2-[4-(bromomethyl)phenyl]-6-methoxy-1,3-benzothiazole. InChIKey: KOXGRZITWONDFB-UHFFFAOYSA-N.
| Molecular formula | C15H12BrNOS |
|---|---|
| Molecular weight | 334.2 g/mol |
| IUPAC name | 2-[4-(bromomethyl)phenyl]-6-methoxy-1,3-benzothiazole |
| InChIKey | KOXGRZITWONDFB-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)N=C(S2)C3=CC=C(C=C3)CBr |
Computed by PubChem (NCBI)