CAS 2803476-77-7 appears in our catalog under these names: 2-(4-(Methylsulfonyl)piperazin-1-yl)ethanamine dihydrochloride, 97%, 97%, 2-(4-(Methylsulfonyl)piperazin-1-yl)ethanamine dihydrochloride, 97%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
2-(4-methylsulfonylpiperazin-1-yl)ethanamine;dihydrochloride (CAS 2803476-77-7) is a chemical compound with the molecular formula C7H19Cl2N3O2S and a molecular weight of 280.22 g/mol. IUPAC name: 2-(4-methylsulfonylpiperazin-1-yl)ethanamine;dihydrochloride. InChIKey: KSRPEJOGYLDYES-UHFFFAOYSA-N.
| Molecular formula | C7H19Cl2N3O2S |
|---|---|
| Molecular weight | 280.22 g/mol |
| IUPAC name | 2-(4-methylsulfonylpiperazin-1-yl)ethanamine;dihydrochloride |
| InChIKey | KSRPEJOGYLDYES-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)N1CCN(CC1)CCN.Cl.Cl |
Computed by PubChem (NCBI)