2-(4-(tert-Butyl)phenyl)-4-phenyl-1H-pyrrole, 95%
cas: 1398056-88-6 — see every product listed under this CAS number, including other names
2-(4-(tert-Butyl)phenyl)-4-phenyl-1H-pyrrole, 95% (CAS 1398056-88-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1555213-250mg |
| cas | 1398056-88-6 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 631.81 Pln | |
| Ambeed | 1g | 1621.94 Pln | |
| Ambeed | 5g | 6261.06 Pln | |
| Chemat | 100mg | 342.80 Pln | |
| Chemat | 250mg | 534.80 Pln | |
| Chemat | 1g | 1336.40 Pln | |
| Chemat | 5g | 5147.60 Pln | |
| BLDpharm | 100mg | 430.98 Pln | |
| BLDpharm | 250mg | 675.34 Pln | |
| BLDpharm | 1g | 1741.63 Pln | |
| BLDpharm | 5g | 6745.43 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
2-(4-tert-butylphenyl)-4-phenyl-1H-pyrrole (CAS 1398056-88-6) is a chemical compound with the molecular formula C20H21N and a molecular weight of 275.4 g/mol. IUPAC name: 2-(4-tert-butylphenyl)-4-phenyl-1H-pyrrole. InChIKey: GWDXAHXRFSDPSM-UHFFFAOYSA-N.
| Molecular formula | C20H21N |
|---|---|
| Molecular weight | 275.4 g/mol |
| IUPAC name | 2-(4-tert-butylphenyl)-4-phenyl-1H-pyrrole |
| InChIKey | GWDXAHXRFSDPSM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)C2=CC(=CN2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)