cas: 7621-86-5 — see every product listed under this CAS number, including other names
2-(4-Aminophenyl)-1H-benzimidazol-5-amine 98% (CAS 7621-86-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A355877-1g |
| cas | 7621-86-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 131.19 Pln | |
| Ambeed | 25g | 203.50 Pln | |
| Ambeed | 100g | 570.62 Pln | |
| Ambeed | 500g | 2083.62 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A355877 |
2-(4-aminophenyl)-3H-benzimidazol-5-amine (CAS 7621-86-5) is a chemical compound with the molecular formula C13H12N4 and a molecular weight of 224.26 g/mol. IUPAC name: 2-(4-aminophenyl)-3H-benzimidazol-5-amine. InChIKey: XAFOTXWPFVZQAZ-UHFFFAOYSA-N.
| Molecular formula | C13H12N4 |
|---|---|
| Molecular weight | 224.26 g/mol |
| IUPAC name | 2-(4-aminophenyl)-3H-benzimidazol-5-amine |
| InChIKey | XAFOTXWPFVZQAZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC3=C(N2)C=C(C=C3)N)N |
Computed by PubChem (NCBI)