cas: 25842-32-4 — see every product listed under this CAS number, including other names
2-(4-Benzylpiperidin-1-yl)ethanamine 95+% (CAS 25842-32-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A557584-100mg |
| cas | 25842-32-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 359.25 Pln | |
| Ambeed | 250mg | 531.69 Pln | |
| Ambeed | 1g | 1221.44 Pln |
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A557584 |
2-(4-benzylpiperidin-1-yl)ethanamine (CAS 25842-32-4) is a chemical compound with the molecular formula C14H22N2 and a molecular weight of 218.34 g/mol. IUPAC name: 2-(4-benzylpiperidin-1-yl)ethanamine. InChIKey: PCNDXYHWLSHXMV-UHFFFAOYSA-N.
| Molecular formula | C14H22N2 |
|---|---|
| Molecular weight | 218.34 g/mol |
| IUPAC name | 2-(4-benzylpiperidin-1-yl)ethanamine |
| InChIKey | PCNDXYHWLSHXMV-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1CC2=CC=CC=C2)CCN |
Computed by PubChem (NCBI)