cas: 850568-67-1 — see every product listed under this CAS number, including other names
2-(4-Boronophenyl)-2-methylpropanenitrile, 97% (CAS 850568-67-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F225311-100MG |
| cas | 850568-67-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 227.02 Pln | |
| Fluorochem | 250mg | 299.91 Pln | |
| Fluorochem | 1g | 456.11 Pln | |
| Fluorochem | 5g | 1294.35 Pln | |
| Fluorochem | 10g | 2538.71 Pln | |
| Fluorochem | 25g | 5261.71 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
[4-(2-cyanopropan-2-yl)phenyl]boronic acid (CAS 850568-67-1) is a chemical compound with the molecular formula C10H12BNO2 and a molecular weight of 189.02 g/mol. IUPAC name: [4-(2-cyanopropan-2-yl)phenyl]boronic acid. InChIKey: BNXBFDTWYHAEIR-UHFFFAOYSA-N.
| Molecular formula | C10H12BNO2 |
|---|---|
| Molecular weight | 189.02 g/mol |
| IUPAC name | [4-(2-cyanopropan-2-yl)phenyl]boronic acid |
| InChIKey | BNXBFDTWYHAEIR-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C(C)(C)C#N)(O)O |
Computed by PubChem (NCBI)